![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| scummvm-2.10.0git-190-gcb2ed7a30ca-general-win32.7z | 2024-11-21 10:26 | 133M | WINTERMUTE: Unmark games as required 3d feature |
| scummvm-2.10.0git-190-gcb2ed7a30ca-general-win32.exe | 2024-11-21 10:24 | 135M | WINTERMUTE: Unmark games as required 3d feature |
| scummvm-2.10.0git-191-g10665fb7236-general-win32.7z | 2024-11-21 12:07 | 133M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.10.0git-191-g10665fb7236-general-win32.exe | 2024-11-21 12:05 | 135M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.10.0git-192-gfeef4e1bf16-general-win32.7z | 2024-11-21 12:23 | 133M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.10.0git-192-gfeef4e1bf16-general-win32.exe | 2024-11-21 12:21 | 135M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.10.0git-193-g0f85939bc5e-general-win32.7z | 2024-11-21 12:39 | 133M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.10.0git-193-g0f85939bc5e-general-win32.exe | 2024-11-21 12:36 | 135M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.10.0git-194-g05052ea66fc-general-win32.7z | 2024-11-21 15:17 | 133M | AMIGAOS: Revert already default settings |
| scummvm-2.10.0git-194-g05052ea66fc-general-win32.exe | 2024-11-21 15:14 | 135M | AMIGAOS: Revert already default settings |
| scummvm-2.10.0git-195-g3a905b90919-general-win32.7z | 2024-11-21 17:42 | 133M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.10.0git-195-g3a905b90919-general-win32.exe | 2024-11-21 17:40 | 135M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.10.0git-196-g80104022d6a-general-win32.7z | 2024-11-21 18:18 | 133M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.10.0git-196-g80104022d6a-general-win32.exe | 2024-11-21 18:16 | 135M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.10.0git-197-g4624dc9116c-general-win32.7z | 2024-11-21 20:07 | 133M | WINTERMUTE: Correctly implement W/A for TGA decoder |
| scummvm-2.10.0git-197-g4624dc9116c-general-win32.exe | 2024-11-21 20:05 | 135M | WINTERMUTE: Correctly implement W/A for TGA decoder |
| scummvm-2.10.0git-198-ge4be9c2b911-general-win32.7z | 2024-11-21 20:22 | 133M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.10.0git-198-ge4be9c2b911-general-win32.exe | 2024-11-21 20:20 | 135M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.10.0git-199-gdc978759b06-general-win32.7z | 2024-11-21 20:37 | 133M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.10.0git-199-gdc978759b06-general-win32.exe | 2024-11-21 20:35 | 135M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.10.0git-200-g083ab320d5d-general-win32.7z | 2024-11-21 23:07 | 133M | WINTERMUTE: Turn off blending for 3d setup render mode |
| scummvm-2.10.0git-200-g083ab320d5d-general-win32.exe | 2024-11-21 23:05 | 135M | WINTERMUTE: Turn off blending for 3d setup render mode |
| scummvm-2.10.0git-201-gaeacf0820fa-general-win32.7z | 2024-11-21 23:21 | 133M | SCUMM: Save mouse position for Mac GUI games, still ignore it on load |
| scummvm-2.10.0git-201-gaeacf0820fa-general-win32.exe | 2024-11-21 23:19 | 135M | SCUMM: Save mouse position for Mac GUI games, still ignore it on load |
| scummvm-2.10.0git-202-g74cb067a6c9-general-win32.7z | 2024-11-21 23:35 | 133M | GOB: add german CD-i version of Gobliins 1 to detection |
| scummvm-2.10.0git-202-g74cb067a6c9-general-win32.exe | 2024-11-21 23:33 | 135M | GOB: add german CD-i version of Gobliins 1 to detection |
| scummvm-2.10.0git-203-gd30acbc6191-general-win32.7z | 2024-11-21 23:49 | 133M | SCUMM: Extend the fix for bug #15520 to cover all v5 Mac games |
| scummvm-2.10.0git-203-gd30acbc6191-general-win32.exe | 2024-11-21 23:47 | 135M | SCUMM: Extend the fix for bug #15520 to cover all v5 Mac games |
| scummvm-2.10.0git-204-ga76f5ccdbfc-general-win32.7z | 2024-11-22 00:03 | 133M | DARKSEED: Clip sprites to game window. |
| scummvm-2.10.0git-204-ga76f5ccdbfc-general-win32.exe | 2024-11-22 00:01 | 135M | DARKSEED: Clip sprites to game window. |
| scummvm-2.10.0git-205-g374d46e0a8e-general-win32.7z | 2024-11-22 00:17 | 133M | DARKSEED: Flush config to disk when toggling mute from in-game menu. |
| scummvm-2.10.0git-205-g374d46e0a8e-general-win32.exe | 2024-11-22 00:15 | 135M | DARKSEED: Flush config to disk when toggling mute from in-game menu. |
| scummvm-2.10.0git-206-g68c1476d3a2-general-win32.7z | 2024-11-22 01:07 | 133M | M4: RIDDLE: Room 701: Start implementing Daemon (up to trigger 102) |
| scummvm-2.10.0git-206-g68c1476d3a2-general-win32.exe | 2024-11-22 01:05 | 135M | M4: RIDDLE: Room 701: Start implementing Daemon (up to trigger 102) |
| scummvm-2.10.0git-207-gc89f796902c-general-win32.7z | 2024-11-22 01:21 | 133M | QDENGINE: Remove g_runtime usage in TimeManager in adv/minigames |
| scummvm-2.10.0git-207-gc89f796902c-general-win32.exe | 2024-11-22 01:19 | 135M | QDENGINE: Remove g_runtime usage in TimeManager in adv/minigames |
| scummvm-2.10.0git-208-gb44c2d6322a-general-win32.7z | 2024-11-22 01:35 | 133M | BACKENDS: SDL: Fix default scale factor used in initSizeHint |
| scummvm-2.10.0git-208-gb44c2d6322a-general-win32.exe | 2024-11-22 01:33 | 135M | BACKENDS: SDL: Fix default scale factor used in initSizeHint |
| scummvm-2.10.0git-209-g38a25cc5219-general-win32.7z | 2024-11-22 01:49 | 133M | KYRA: (EOB) - fix Ring of Wizardry effect |
| scummvm-2.10.0git-209-g38a25cc5219-general-win32.exe | 2024-11-22 01:47 | 135M | KYRA: (EOB) - fix Ring of Wizardry effect |
| scummvm-2.10.0git-210-g8367736a31e-general-win32.7z | 2024-11-22 02:04 | 133M | M4: RIDDLE: Room 701: Implement inventoryCheck |
| scummvm-2.10.0git-210-g8367736a31e-general-win32.exe | 2024-11-22 02:01 | 135M | M4: RIDDLE: Room 701: Implement inventoryCheck |
| scummvm-2.10.0git-211-gb7867fd5650-general-win32.7z | 2024-11-22 04:07 | 133M | AGI: PREAGI: Fix WINNIE Apple II tree house |
| scummvm-2.10.0git-211-gb7867fd5650-general-win32.exe | 2024-11-22 04:05 | 135M | AGI: PREAGI: Fix WINNIE Apple II tree house |
| scummvm-2.10.0git-212-g8079ef4294e-general-win32.7z | 2024-11-22 04:22 | 133M | AGI: PREAGI: Fix WINNIE wind behavior |
| scummvm-2.10.0git-212-g8079ef4294e-general-win32.exe | 2024-11-22 04:20 | 135M | AGI: PREAGI: Fix WINNIE wind behavior |
| scummvm-2.10.0git-213-g734257f348f-general-win32.7z | 2024-11-22 04:38 | 133M | AGI: PREAGI: Implement WINNIE timer and events |
| scummvm-2.10.0git-213-g734257f348f-general-win32.exe | 2024-11-22 04:36 | 135M | AGI: PREAGI: Implement WINNIE timer and events |
| scummvm-2.10.0git-214-gf4e0bab98df-general-win32.7z | 2024-11-22 04:54 | 133M | AGI: PREAGI: Fix WINNIE RNG calls |
| scummvm-2.10.0git-214-gf4e0bab98df-general-win32.exe | 2024-11-22 04:52 | 135M | AGI: PREAGI: Fix WINNIE RNG calls |
| scummvm-2.10.0git-215-g7d6bdd9ab3e-general-win32.7z | 2024-11-22 05:10 | 133M | AGI: PREAGI: Fix WINNIE Amiga object parsing |
| scummvm-2.10.0git-215-g7d6bdd9ab3e-general-win32.exe | 2024-11-22 05:08 | 135M | AGI: PREAGI: Fix WINNIE Amiga object parsing |
| scummvm-2.10.0git-216-gc2ed579734c-general-win32.7z | 2024-11-22 06:07 | 133M | M4: RIDDLE: Twelvetrees conv fixes |
| scummvm-2.10.0git-216-gc2ed579734c-general-win32.exe | 2024-11-22 06:05 | 135M | M4: RIDDLE: Twelvetrees conv fixes |
| scummvm-2.10.0git-217-ge44de893260-general-win32.7z | 2024-11-22 06:23 | 133M | M4: RIDDLE: Twelvetrees conv fixes |
| scummvm-2.10.0git-217-ge44de893260-general-win32.exe | 2024-11-22 06:21 | 135M | M4: RIDDLE: Twelvetrees conv fixes |
| scummvm-2.10.0git-218-gc697c93af66-general-win32.7z | 2024-11-22 06:39 | 133M | M4: RIDDLE: Fix crashes loading Easter Island background noises |
| scummvm-2.10.0git-218-gc697c93af66-general-win32.exe | 2024-11-22 06:36 | 135M | M4: RIDDLE: Fix crashes loading Easter Island background noises |
| scummvm-2.10.0git-219-g66deea84d76-general-win32.7z | 2024-11-22 06:54 | 133M | M4: RIDDLE: Fixes for untying Twelvetrees cutscene |
| scummvm-2.10.0git-219-g66deea84d76-general-win32.exe | 2024-11-22 06:52 | 135M | M4: RIDDLE: Fixes for untying Twelvetrees cutscene |
| scummvm-2.10.0git-220-gc96012f37f7-general-win32.7z | 2024-11-22 08:08 | 133M | M4: Fix flags array to only allow Flag enums |
| scummvm-2.10.0git-220-gc96012f37f7-general-win32.exe | 2024-11-22 08:06 | 135M | M4: Fix flags array to only allow Flag enums |
| scummvm-2.10.0git-221-geda1cb9e216-general-win32.7z | 2024-11-22 10:07 | 133M | DIRECTOR: Add detection for the demo version of Safecracker |
| scummvm-2.10.0git-221-geda1cb9e216-general-win32.exe | 2024-11-22 10:05 | 135M | DIRECTOR: Add detection for the demo version of Safecracker |
| scummvm-2.10.0git-222-gac06a27c062-general-win32.7z | 2024-11-22 10:24 | 133M | ENGINES: Define that a game is using 3D graphics on init - bug #15521 |
| scummvm-2.10.0git-222-gac06a27c062-general-win32.exe | 2024-11-22 10:22 | 135M | ENGINES: Define that a game is using 3D graphics on init - bug #15521 |
| scummvm-2.10.0git-223-gff57bb851b7-general-win32.7z | 2024-11-22 12:07 | 133M | DGDS: Add CDS:TT3 data to packed data list |
| scummvm-2.10.0git-223-gff57bb851b7-general-win32.exe | 2024-11-22 12:05 | 135M | DGDS: Add CDS:TT3 data to packed data list |
| scummvm-2.10.0git-224-g1c8bf5205fa-general-win32.7z | 2024-11-22 12:23 | 133M | DGDS: Initial support for Willy Beamish voice acting |
| scummvm-2.10.0git-224-g1c8bf5205fa-general-win32.exe | 2024-11-22 12:21 | 135M | DGDS: Initial support for Willy Beamish voice acting |
| scummvm-2.10.0git-225-g12863fb4570-general-win32.7z | 2024-11-22 13:07 | 133M | GROOVIE: Remove unneeded USE_RGB_COLOR ifdef |
| scummvm-2.10.0git-225-g12863fb4570-general-win32.exe | 2024-11-22 13:05 | 135M | GROOVIE: Remove unneeded USE_RGB_COLOR ifdef |
| scummvm-2.10.0git-226-g5c9b16093b1-general-win32.7z | 2024-11-22 17:07 | 133M | AMIGAOS: Clean up configure |
| scummvm-2.10.0git-226-g5c9b16093b1-general-win32.exe | 2024-11-22 17:05 | 135M | AMIGAOS: Clean up configure |
| scummvm-2.10.0git-227-gc8e3f4f7755-general-win32.7z | 2024-11-23 00:07 | 133M | QDENGINE: Eliminated more g_runtime usage in adv minigames |
| scummvm-2.10.0git-227-gc8e3f4f7755-general-win32.exe | 2024-11-23 00:05 | 135M | QDENGINE: Eliminated more g_runtime usage in adv minigames |
| scummvm-2.10.0git-228-g1abd39347bd-general-win32.7z | 2024-11-23 02:07 | 133M | DARKSEED: Show console while running bed wake sequence |
| scummvm-2.10.0git-228-g1abd39347bd-general-win32.exe | 2024-11-23 02:05 | 135M | DARKSEED: Show console while running bed wake sequence |
| scummvm-2.10.0git-229-g77fb10386bf-general-win32.7z | 2024-11-23 02:23 | 133M | DARKSEED: Fix bug where player moves when loading a new room |
| scummvm-2.10.0git-229-g77fb10386bf-general-win32.exe | 2024-11-23 02:20 | 135M | DARKSEED: Fix bug where player moves when loading a new room |
| scummvm-2.10.0git-230-g1b18faa5c51-general-win32.7z | 2024-11-23 02:39 | 133M | DARKSEED: Confirm quit from menu with left mouse click. |
| scummvm-2.10.0git-230-g1b18faa5c51-general-win32.exe | 2024-11-23 02:36 | 135M | DARKSEED: Confirm quit from menu with left mouse click. |
| scummvm-2.10.0git-231-gb673c071159-general-win32.7z | 2024-11-23 02:55 | 133M | DGDS: Fix swapped buffers in TTM 0xB606 operation |
| scummvm-2.10.0git-231-gb673c071159-general-win32.exe | 2024-11-23 02:52 | 135M | DGDS: Fix swapped buffers in TTM 0xB606 operation |
| scummvm-2.10.0git-232-g48942109179-general-win32.7z | 2024-11-23 03:11 | 133M | DGDS: Avoid potential use of deallocated memory |
| scummvm-2.10.0git-232-g48942109179-general-win32.exe | 2024-11-23 03:09 | 135M | DGDS: Avoid potential use of deallocated memory |
| scummvm-2.10.0git-233-gaa0b9b7d66a-general-win32.7z | 2024-11-23 03:28 | 133M | DGDS: Support more mouse cursors for Willy Beamish |
| scummvm-2.10.0git-233-gaa0b9b7d66a-general-win32.exe | 2024-11-23 03:25 | 135M | DGDS: Support more mouse cursors for Willy Beamish |
| scummvm-2.10.0git-234-gcc495c02e05-general-win32.7z | 2024-11-23 04:08 | 133M | DARKSEED: Fixed scaling position of sprites when cop arrests Mike |
| scummvm-2.10.0git-234-gcc495c02e05-general-win32.exe | 2024-11-23 04:05 | 135M | DARKSEED: Fixed scaling position of sprites when cop arrests Mike |
| scummvm-2.10.0git-235-g50004a2cb1b-general-win32.7z | 2024-11-23 04:25 | 133M | DARKSEED: Fixed scaling position of sprites when Mike throws stick |
| scummvm-2.10.0git-235-g50004a2cb1b-general-win32.exe | 2024-11-23 04:22 | 135M | DARKSEED: Fixed scaling position of sprites when Mike throws stick |
| scummvm-2.10.0git-236-g5dbc36ddc05-general-win32.7z | 2024-11-23 05:08 | 133M | DGDS: Fix clip window setting |
| scummvm-2.10.0git-236-g5dbc36ddc05-general-win32.exe | 2024-11-23 05:05 | 135M | DGDS: Fix clip window setting |
| scummvm-2.10.0git-237-g5a532801df0-general-win32.7z | 2024-11-23 05:24 | 133M | DGDS: Ensure scroll image drawn correctly |
| scummvm-2.10.0git-237-g5a532801df0-general-win32.exe | 2024-11-23 05:22 | 135M | DGDS: Ensure scroll image drawn correctly |
| scummvm-2.10.0git-238-g0edaf859d34-general-win32.7z | 2024-11-23 10:08 | 133M | FREESCAPE: more tinygl fixes to avoid rounding issues |
| scummvm-2.10.0git-238-g0edaf859d34-general-win32.exe | 2024-11-23 10:05 | 135M | FREESCAPE: more tinygl fixes to avoid rounding issues |
| scummvm-2.10.0git-239-g66df0b3f541-general-win32.7z | 2024-11-23 10:23 | 133M | FREESCAPE: tweak glPolygonOffset values |
| scummvm-2.10.0git-239-g66df0b3f541-general-win32.exe | 2024-11-23 10:21 | 135M | FREESCAPE: tweak glPolygonOffset values |
| scummvm-2.10.0git-240-g867960e60d5-general-win32.exe | 2024-11-23 10:37 | 135M | |