![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| scummvm-2.9.0pre-90-gd3f79b86806-general-win32.7z | 2024-11-21 21:05 | 126M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.9.0pre-90-gd3f79b86806-general-win32.exe | 2024-11-21 21:03 | 128M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.9.0pre-89-gdba399b215d-general-win32.7z | 2024-11-21 20:51 | 126M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.9.0pre-89-gdba399b215d-general-win32.exe | 2024-11-21 20:50 | 128M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.9.0pre-88-g27c2dd0e6be-general-win32.7z | 2024-11-21 19:35 | 126M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.9.0pre-88-g27c2dd0e6be-general-win32.exe | 2024-11-21 19:34 | 128M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.9.0pre-87-g68723bfce2f-general-win32.7z | 2024-11-21 19:02 | 126M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.9.0pre-87-g68723bfce2f-general-win32.exe | 2024-11-21 19:00 | 128M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.9.0pre-86-g209183da76a-general-win32.7z | 2024-11-21 16:20 | 126M | I18N: Update translation (Chinese (Simplified Han script)) |
| scummvm-2.9.0pre-86-g209183da76a-general-win32.exe | 2024-11-21 16:18 | 128M | I18N: Update translation (Chinese (Simplified Han script)) |
| scummvm-2.9.0pre-85-g6088402a9a7-general-win32.7z | 2024-11-21 16:02 | 126M | I18N: Update translation (French) |
| scummvm-2.9.0pre-85-g6088402a9a7-general-win32.exe | 2024-11-21 16:00 | 128M | I18N: Update translation (French) |
| scummvm-2.9.0pre-84-ge44ccff5a24-general-win32.7z | 2024-11-21 15:42 | 126M | I18N: Update translation (French) |
| scummvm-2.9.0pre-84-ge44ccff5a24-general-win32.exe | 2024-11-21 15:39 | 128M | I18N: Update translation (French) |
| scummvm-2.9.0pre-83-g8b09fecb8d9-general-win32.7z | 2024-11-21 14:08 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-83-g8b09fecb8d9-general-win32.exe | 2024-11-21 14:06 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-82-gf833958bd7a-general-win32.7z | 2024-11-21 13:40 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-82-gf833958bd7a-general-win32.exe | 2024-11-21 13:38 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-81-gf18147a08a8-general-win32.7z | 2024-11-21 13:24 | 126M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.9.0pre-81-gf18147a08a8-general-win32.exe | 2024-11-21 13:22 | 128M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.9.0pre-80-g3d60a8e5064-general-win32.7z | 2024-11-21 13:10 | 126M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.9.0pre-80-g3d60a8e5064-general-win32.exe | 2024-11-21 13:08 | 128M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.9.0pre-79-g1e46fb774b8-general-win32.7z | 2024-11-21 12:56 | 126M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.9.0pre-79-g1e46fb774b8-general-win32.exe | 2024-11-21 12:54 | 128M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.9.0pre-78-gfb53ab6511d-general-win32.7z | 2024-11-21 07:07 | 126M | I18N: Update translation (Japanese) |
| scummvm-2.9.0pre-78-gfb53ab6511d-general-win32.exe | 2024-11-21 07:05 | 128M | I18N: Update translation (Japanese) |
| scummvm-2.9.0pre-77-g74be1c4b816-general-win32.7z | 2024-11-21 02:01 | 126M | TETRAEDGE: Fix exit confirmation for Syberia II - bug #14352 |
| scummvm-2.9.0pre-77-g74be1c4b816-general-win32.exe | 2024-11-21 01:59 | 128M | TETRAEDGE: Fix exit confirmation for Syberia II - bug #14352 |
| scummvm-2.9.0pre-76-g2d45d35b14f-general-win32.7z | 2024-11-20 23:18 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-76-g2d45d35b14f-general-win32.exe | 2024-11-20 23:16 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-75-g8b4f333e7c9-general-win32.7z | 2024-11-20 23:01 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-75-g8b4f333e7c9-general-win32.exe | 2024-11-20 22:59 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-74-gdcefad88690-general-win32.7z | 2024-11-20 22:43 | 126M | SCUMM: DOTT: Disable copy protection |
| scummvm-2.9.0pre-74-gdcefad88690-general-win32.exe | 2024-11-20 22:41 | 128M | SCUMM: DOTT: Disable copy protection |
| scummvm-2.9.0pre-73-gaba55234820-general-win32.7z | 2024-11-20 22:27 | 126M | SCUMM: DOTT: Partial fix for hotspots being unclickable after load |
| scummvm-2.9.0pre-73-gaba55234820-general-win32.exe | 2024-11-20 22:25 | 128M | SCUMM: DOTT: Partial fix for hotspots being unclickable after load |
| scummvm-2.9.0pre-72-g493e75f3703-general-win32.7z | 2024-11-20 12:45 | 126M | DIRECTOR: remove redundant string decode |
| scummvm-2.9.0pre-72-g493e75f3703-general-win32.exe | 2024-11-20 12:42 | 128M | DIRECTOR: remove redundant string decode |
| scummvm-2.9.0pre-71-g4770bd0046b-general-win32.7z | 2024-11-20 12:29 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-71-g4770bd0046b-general-win32.exe | 2024-11-20 12:27 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-70-gcf089719d04-general-win32.7z | 2024-11-20 11:43 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-70-gcf089719d04-general-win32.exe | 2024-11-20 11:41 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-69-g9f88076d6c2-general-win32.7z | 2024-11-20 11:26 | 126M | ULTIMA: NUVIE: Enable key repeat on walk ops |
| scummvm-2.9.0pre-69-g9f88076d6c2-general-win32.exe | 2024-11-20 11:24 | 128M | ULTIMA: NUVIE: Enable key repeat on walk ops |
| scummvm-2.9.0pre-68-gef04ec6aa5a-general-win32.7z | 2024-11-20 08:15 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-68-gef04ec6aa5a-general-win32.exe | 2024-11-20 08:13 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-67-g59a12d772f7-general-win32.7z | 2024-11-20 07:58 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-67-g59a12d772f7-general-win32.exe | 2024-11-20 07:56 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-66-gc9817cb05a0-general-win32.7z | 2024-11-20 07:41 | 126M | GOB: Add missing commands to the console help text |
| scummvm-2.9.0pre-66-gc9817cb05a0-general-win32.exe | 2024-11-20 07:39 | 128M | GOB: Add missing commands to the console help text |
| scummvm-2.9.0pre-65-g514bb7fbc82-general-win32.7z | 2024-11-20 07:26 | 126M | ENGINES: Use common GFX code for 3D games - fixes part of bug #14342 |
| scummvm-2.9.0pre-65-g514bb7fbc82-general-win32.exe | 2024-11-20 07:24 | 128M | ENGINES: Use common GFX code for 3D games - fixes part of bug #14342 |
| scummvm-2.9.0pre-64-gdbece0f7293-general-win32.7z | 2024-11-20 05:16 | 126M | NEWS: Fix typo in German NEWS file |
| scummvm-2.9.0pre-64-gdbece0f7293-general-win32.exe | 2024-11-20 05:14 | 128M | NEWS: Fix typo in German NEWS file |
| scummvm-2.9.0pre-63-g4314a44b105-general-win32.7z | 2024-11-20 05:01 | 126M | NEWS: Update German NEWS file |
| scummvm-2.9.0pre-63-g4314a44b105-general-win32.exe | 2024-11-20 04:59 | 128M | NEWS: Update German NEWS file |
| scummvm-2.9.0pre-62-g6366542407e-general-win32.7z | 2024-11-20 00:49 | 126M | AGS: Enabled achievements for several games |
| scummvm-2.9.0pre-62-g6366542407e-general-win32.exe | 2024-11-20 00:47 | 128M | AGS: Enabled achievements for several games |
| scummvm-2.9.0pre-61-gebc57497ae5-general-win32.7z | 2024-11-20 00:34 | 126M | ACHIEVEMENTS: Generated description files |
| scummvm-2.9.0pre-61-gebc57497ae5-general-win32.exe | 2024-11-20 00:32 | 128M | ACHIEVEMENTS: Generated description files |
| scummvm-2.9.0pre-60-g554c00b6e89-general-win32.7z | 2024-11-20 00:21 | 126M | ACHIEVEMENTS: Add several AGS games |
| scummvm-2.9.0pre-60-g554c00b6e89-general-win32.exe | 2024-11-20 00:19 | 128M | ACHIEVEMENTS: Add several AGS games |
| scummvm-2.9.0pre-59-g4b96355ff7c-general-win32.7z | 2024-11-19 16:08 | 126M | I18N: Update translation (Italian) |
| scummvm-2.9.0pre-59-g4b96355ff7c-general-win32.exe | 2024-11-19 16:06 | 128M | I18N: Update translation (Italian) |
| scummvm-2.9.0pre-58-g3b4d3ccfcde-general-win32.7z | 2024-11-19 10:25 | 126M | DGDS: Fix VQT image decoding on big-endian systems (Trac#15506) |
| scummvm-2.9.0pre-58-g3b4d3ccfcde-general-win32.exe | 2024-11-19 10:23 | 128M | DGDS: Fix VQT image decoding on big-endian systems (Trac#15506) |
| scummvm-2.9.0pre-57-g526016f8fc4-general-win32.7z | 2024-11-18 21:46 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-57-g526016f8fc4-general-win32.exe | 2024-11-18 21:43 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-56-g3641648ece7-general-win32.7z | 2024-11-18 21:29 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-56-g3641648ece7-general-win32.exe | 2024-11-18 21:27 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-55-gd4b08b03de2-general-win32.7z | 2024-11-18 21:12 | 126M | GOB: Add version fallback from our detection tables - bug #14857 |
| scummvm-2.9.0pre-55-gd4b08b03de2-general-win32.exe | 2024-11-18 21:10 | 128M | GOB: Add version fallback from our detection tables - bug #14857 |
| scummvm-2.9.0pre-54-g2483e4e7b07-general-win32.7z | 2024-11-18 20:55 | 126M | GOB: Skip the copy protection screen in the Amiga version of Gob2 |
| scummvm-2.9.0pre-54-g2483e4e7b07-general-win32.exe | 2024-11-18 20:53 | 128M | GOB: Skip the copy protection screen in the Amiga version of Gob2 |
| scummvm-2.9.0pre-53-g9dad063b59b-general-win32.7z | 2024-11-18 20:37 | 126M | QDENGINE: Added support for 3mice1-pl minigames |
| scummvm-2.9.0pre-53-g9dad063b59b-general-win32.exe | 2024-11-18 20:35 | 128M | QDENGINE: Added support for 3mice1-pl minigames |
| scummvm-2.9.0pre-52-gb683a465073-general-win32.7z | 2024-11-18 20:19 | 126M | QDENGINE: Print movie name when stream is failed to load |
| scummvm-2.9.0pre-52-gb683a465073-general-win32.exe | 2024-11-18 20:17 | 128M | QDENGINE: Print movie name when stream is failed to load |
| scummvm-2.9.0pre-51-g2ae37acea4a-general-win32.7z | 2024-11-18 20:05 | 126M | QDENGINE: Added detection for 3mice1-pl |
| scummvm-2.9.0pre-51-g2ae37acea4a-general-win32.exe | 2024-11-18 20:03 | 128M | QDENGINE: Added detection for 3mice1-pl |
| scummvm-2.9.0pre-50-g5ad53ef627f-general-win32.7z | 2024-11-18 08:57 | 126M | M4: Fix setting verb when adding custom hotspots |
| scummvm-2.9.0pre-50-g5ad53ef627f-general-win32.exe | 2024-11-18 08:55 | 128M | M4: Fix setting verb when adding custom hotspots |
| scummvm-2.9.0pre-49-g720393a6f69-general-win32.7z | 2024-11-18 08:40 | 126M | SCUMM: MACGUI: Never fail to initialize the Mac GUI for Loom/Indy3 |
| scummvm-2.9.0pre-49-g720393a6f69-general-win32.exe | 2024-11-18 08:38 | 128M | SCUMM: MACGUI: Never fail to initialize the Mac GUI for Loom/Indy3 |
| scummvm-2.9.0pre-48-g91946ccdc7c-general-win32.7z | 2024-11-17 23:29 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-48-g91946ccdc7c-general-win32.exe | 2024-11-17 23:28 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-47-g2885264e163-general-win32.7z | 2024-11-17 23:14 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-47-g2885264e163-general-win32.exe | 2024-11-17 23:12 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-46-g2ac2d854d9c-general-win32.7z | 2024-11-17 22:58 | 126M | SCUMM: fix invalid mem access (bug no. 15507) |
| scummvm-2.9.0pre-46-g2ac2d854d9c-general-win32.exe | 2024-11-17 22:56 | 128M | SCUMM: fix invalid mem access (bug no. 15507) |
| scummvm-2.9.0pre-45-g53b604c4da8-general-win32.7z | 2024-11-17 22:42 | 126M | SCI: Add Japanese version of KQ7 - bug #15497 |
| scummvm-2.9.0pre-45-g53b604c4da8-general-win32.exe | 2024-11-17 22:40 | 128M | SCI: Add Japanese version of KQ7 - bug #15497 |
| scummvm-2.9.0pre-44-g1bce1cedae3-general-win32.7z | 2024-11-17 22:28 | 126M | SCUMM: Avoid memset for initializing non-trivial types |
| scummvm-2.9.0pre-44-g1bce1cedae3-general-win32.exe | 2024-11-17 22:26 | 128M | SCUMM: Avoid memset for initializing non-trivial types |
| scummvm-2.9.0pre-43-gfc426ddc0f2-general-win32.7z | 2024-11-17 15:34 | 126M | I18N: Update translation files |
| scummvm-2.9.0pre-43-gfc426ddc0f2-general-win32.exe | 2024-11-17 15:32 | 128M | I18N: Update translation files |
| scummvm-2.9.0pre-42-gb4515427ea8-general-win32.7z | 2024-11-17 15:18 | 126M | I18N: Update translations templates |
| scummvm-2.9.0pre-42-gb4515427ea8-general-win32.exe | 2024-11-17 15:16 | 128M | I18N: Update translations templates |
| scummvm-2.9.0pre-41-g28fd30fb844-general-win32.7z | 2024-11-17 15:02 | 126M | SCUMM: INDY3/LOOM (Mac): Force _macGui init to allow font resources loading |
| scummvm-2.9.0pre-41-g28fd30fb844-general-win32.exe | 2024-11-17 15:00 | 128M | SCUMM: INDY3/LOOM (Mac): Force _macGui init to allow font resources loading |