![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| scummvm-2.9.0pre-69-g9f88076d6c2-winxp-win32.exe | 2024-11-20 11:32 | 125M | ULTIMA: NUVIE: Enable key repeat on walk ops |
| scummvm-2.9.0pre-69-g9f88076d6c2-winxp-win32.7z | 2024-11-20 11:34 | 125M | ULTIMA: NUVIE: Enable key repeat on walk ops |
| scummvm-2.9.0pre-88-g27c2dd0e6be-winxp-win32.exe | 2024-11-21 19:40 | 125M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.9.0pre-88-g27c2dd0e6be-winxp-win32.7z | 2024-11-21 19:42 | 125M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.9.0pre-87-g68723bfce2f-winxp-win32.exe | 2024-11-21 19:27 | 125M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.9.0pre-87-g68723bfce2f-winxp-win32.7z | 2024-11-21 19:29 | 125M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.9.0pre-77-g74be1c4b816-winxp-win32.exe | 2024-11-21 02:07 | 125M | TETRAEDGE: Fix exit confirmation for Syberia II - bug #14352 |
| scummvm-2.9.0pre-77-g74be1c4b816-winxp-win32.7z | 2024-11-21 02:10 | 125M | TETRAEDGE: Fix exit confirmation for Syberia II - bug #14352 |
| scummvm-2.9.0pre-94-g05d2e52c6df-winxp-win32.exe | 2024-11-21 22:03 | 125M | SCUMM: Save mouse position for Mac GUI games, still ignore it on load |
| scummvm-2.9.0pre-94-g05d2e52c6df-winxp-win32.7z | 2024-11-21 22:05 | 125M | SCUMM: Save mouse position for Mac GUI games, still ignore it on load |
| scummvm-2.9.0pre-93-gf4567290f67-winxp-win32.exe | 2024-11-21 21:50 | 125M | SCUMM: MACGUI: Optimize Mac palette handling (bug #15492) |
| scummvm-2.9.0pre-93-gf4567290f67-winxp-win32.7z | 2024-11-21 21:52 | 125M | SCUMM: MACGUI: Optimize Mac palette handling (bug #15492) |
| scummvm-2.9.0pre-89-gdba399b215d-winxp-win32.exe | 2024-11-21 20:56 | 125M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.9.0pre-89-gdba399b215d-winxp-win32.7z | 2024-11-21 20:58 | 125M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.9.0pre-90-gd3f79b86806-winxp-win32.exe | 2024-11-21 21:10 | 125M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.9.0pre-90-gd3f79b86806-winxp-win32.7z | 2024-11-21 21:12 | 125M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.9.0pre-98-g971573904cf-winxp-win32.exe | 2024-11-21 22:54 | 125M | SCUMM: Extend the fix for bug #15520 to cover all v5 Mac games |
| scummvm-2.9.0pre-98-g971573904cf-winxp-win32.7z | 2024-11-21 22:56 | 125M | SCUMM: Extend the fix for bug #15520 to cover all v5 Mac games |
| scummvm-2.9.0pre-73-gaba55234820-winxp-win32.exe | 2024-11-20 22:32 | 125M | SCUMM: DOTT: Partial fix for hotspots being unclickable after load |
| scummvm-2.9.0pre-73-gaba55234820-winxp-win32.7z | 2024-11-20 22:34 | 125M | SCUMM: DOTT: Partial fix for hotspots being unclickable after load |
| scummvm-2.9.0pre-74-gdcefad88690-winxp-win32.exe | 2024-11-20 22:50 | 125M | SCUMM: DOTT: Disable copy protection |
| scummvm-2.9.0pre-74-gdcefad88690-winxp-win32.7z | 2024-11-20 22:52 | 125M | SCUMM: DOTT: Disable copy protection |
| scummvm-2.9.0pre-63-g4314a44b105-winxp-win32.exe | 2024-11-20 05:06 | 125M | NEWS: Update German NEWS file |
| scummvm-2.9.0pre-63-g4314a44b105-winxp-win32.7z | 2024-11-20 05:08 | 125M | NEWS: Update German NEWS file |
| scummvm-2.9.0pre-64-gdbece0f7293-winxp-win32.exe | 2024-11-20 05:21 | 125M | NEWS: Fix typo in German NEWS file |
| scummvm-2.9.0pre-64-gdbece0f7293-winxp-win32.7z | 2024-11-20 05:23 | 125M | NEWS: Fix typo in German NEWS file |
| scummvm-2.9.0pre-99-gb85952d7586-winxp-win32.exe | 2024-11-22 00:35 | 125M | KYRA: (EOB) - fix Ring of Wizardry effect |
| scummvm-2.9.0pre-99-gb85952d7586-winxp-win32.7z | 2024-11-22 00:37 | 125M | KYRA: (EOB) - fix Ring of Wizardry effect |
| scummvm-2.9.0pre-95-g355de3b2f85-winxp-win32.exe | 2024-11-21 22:16 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-95-g355de3b2f85-winxp-win32.7z | 2024-11-21 22:18 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-91-gfd8e761f8f5-winxp-win32.exe | 2024-11-21 21:23 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-91-gfd8e761f8f5-winxp-win32.7z | 2024-11-21 21:25 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-82-gf833958bd7a-winxp-win32.exe | 2024-11-21 13:46 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-82-gf833958bd7a-winxp-win32.7z | 2024-11-21 13:48 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-75-g8b4f333e7c9-winxp-win32.exe | 2024-11-20 23:07 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-75-g8b4f333e7c9-winxp-win32.7z | 2024-11-20 23:09 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-70-gcf089719d04-winxp-win32.exe | 2024-11-20 11:50 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-70-gcf089719d04-winxp-win32.7z | 2024-11-20 11:52 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-67-g59a12d772f7-winxp-win32.exe | 2024-11-20 08:05 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-67-g59a12d772f7-winxp-win32.7z | 2024-11-20 08:07 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-56-g3641648ece7-winxp-win32.exe | 2024-11-18 21:35 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-56-g3641648ece7-winxp-win32.7z | 2024-11-18 21:37 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-102-g0d1d86b9a5f-winxp-win32.exe | 2024-11-22 02:50 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-102-g0d1d86b9a5f-winxp-win32.7z | 2024-11-22 02:52 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-96-g52af61603bf-winxp-win32.exe | 2024-11-21 22:29 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-96-g52af61603bf-winxp-win32.7z | 2024-11-21 22:31 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-92-g1f22bda6ab5-winxp-win32.exe | 2024-11-21 21:37 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-92-g1f22bda6ab5-winxp-win32.7z | 2024-11-21 21:39 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-83-g8b09fecb8d9-winxp-win32.exe | 2024-11-21 14:17 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-83-g8b09fecb8d9-winxp-win32.7z | 2024-11-21 14:19 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-76-g2d45d35b14f-winxp-win32.exe | 2024-11-20 23:24 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-76-g2d45d35b14f-winxp-win32.7z | 2024-11-20 23:26 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-71-g4770bd0046b-winxp-win32.exe | 2024-11-20 12:34 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-71-g4770bd0046b-winxp-win32.7z | 2024-11-20 12:37 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-68-gef04ec6aa5a-winxp-win32.exe | 2024-11-20 08:20 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-68-gef04ec6aa5a-winxp-win32.7z | 2024-11-20 08:23 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-57-g526016f8fc4-winxp-win32.exe | 2024-11-18 21:52 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-57-g526016f8fc4-winxp-win32.7z | 2024-11-18 21:54 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-103-g81713e93d05-winxp-win32.exe | 2024-11-22 03:04 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-103-g81713e93d05-winxp-win32.7z | 2024-11-22 03:06 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-78-gfb53ab6511d-winxp-win32.exe | 2024-11-21 07:11 | 125M | I18N: Update translation (Japanese) |
| scummvm-2.9.0pre-78-gfb53ab6511d-winxp-win32.7z | 2024-11-21 07:13 | 125M | I18N: Update translation (Japanese) |
| scummvm-2.9.0pre-59-g4b96355ff7c-winxp-win32.exe | 2024-11-19 16:13 | 125M | I18N: Update translation (Italian) |
| scummvm-2.9.0pre-59-g4b96355ff7c-winxp-win32.7z | 2024-11-19 16:15 | 125M | I18N: Update translation (Italian) |
| scummvm-2.9.0pre-85-g6088402a9a7-winxp-win32.exe | 2024-11-21 16:09 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-85-g6088402a9a7-winxp-win32.7z | 2024-11-21 16:11 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-84-ge44ccff5a24-winxp-win32.exe | 2024-11-21 15:48 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-84-ge44ccff5a24-winxp-win32.7z | 2024-11-21 15:50 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-86-g209183da76a-winxp-win32.exe | 2024-11-21 16:27 | 125M | I18N: Update translation (Chinese (Simplified Han script)) |
| scummvm-2.9.0pre-86-g209183da76a-winxp-win32.7z | 2024-11-21 16:29 | 125M | I18N: Update translation (Chinese (Simplified Han script)) |
| scummvm-2.9.0pre-97-ga302429111d-winxp-win32.exe | 2024-11-21 22:41 | 125M | GOB: add german CD-i version of Gobliins 1 to detection |
| scummvm-2.9.0pre-97-ga302429111d-winxp-win32.7z | 2024-11-21 22:43 | 125M | GOB: add german CD-i version of Gobliins 1 to detection |
| scummvm-2.9.0pre-54-g2483e4e7b07-winxp-win32.exe | 2024-11-18 21:01 | 125M | GOB: Skip the copy protection screen in the Amiga version of Gob2 |
| scummvm-2.9.0pre-54-g2483e4e7b07-winxp-win32.7z | 2024-11-18 21:03 | 125M | GOB: Skip the copy protection screen in the Amiga version of Gob2 |
| scummvm-2.9.0pre-55-gd4b08b03de2-winxp-win32.exe | 2024-11-18 21:18 | 125M | GOB: Add version fallback from our detection tables - bug #14857 |
| scummvm-2.9.0pre-55-gd4b08b03de2-winxp-win32.7z | 2024-11-18 21:20 | 125M | GOB: Add version fallback from our detection tables - bug #14857 |
| scummvm-2.9.0pre-66-gc9817cb05a0-winxp-win32.exe | 2024-11-20 07:48 | 125M | GOB: Add missing commands to the console help text |
| scummvm-2.9.0pre-66-gc9817cb05a0-winxp-win32.7z | 2024-11-20 07:50 | 125M | GOB: Add missing commands to the console help text |
| scummvm-2.9.0pre-65-g514bb7fbc82-winxp-win32.exe | 2024-11-20 07:31 | 125M | ENGINES: Use common GFX code for 3D games - fixes part of bug #14342 |
| scummvm-2.9.0pre-65-g514bb7fbc82-winxp-win32.7z | 2024-11-20 07:33 | 125M | ENGINES: Use common GFX code for 3D games - fixes part of bug #14342 |
| scummvm-2.9.0pre-72-g493e75f3703-winxp-win32.exe | 2024-11-20 12:51 | 125M | DIRECTOR: remove redundant string decode |
| scummvm-2.9.0pre-72-g493e75f3703-winxp-win32.7z | 2024-11-20 12:53 | 125M | DIRECTOR: remove redundant string decode |
| scummvm-2.9.0pre-58-g3b4d3ccfcde-winxp-win32.exe | 2024-11-19 10:30 | 125M | DGDS: Fix VQT image decoding on big-endian systems (Trac#15506) |
| scummvm-2.9.0pre-58-g3b4d3ccfcde-winxp-win32.7z | 2024-11-19 10:32 | 125M | DGDS: Fix VQT image decoding on big-endian systems (Trac#15506) |
| scummvm-2.9.0pre-100-g677712e05a4-winxp-win32.exe | 2024-11-22 02:23 | 125M | BACKENDS: SDL: Never make window smaller in OpenGL mode when starting game |
| scummvm-2.9.0pre-100-g677712e05a4-winxp-win32.7z | 2024-11-22 02:25 | 125M | BACKENDS: SDL: Never make window smaller in OpenGL mode when starting game |
| scummvm-2.9.0pre-101-gc08ace2b72c-winxp-win32.exe | 2024-11-22 02:37 | 125M | BACKENDS: SDL: Fix default scale factor used in initSizeHint |
| scummvm-2.9.0pre-101-gc08ace2b72c-winxp-win32.7z | 2024-11-22 02:39 | 125M | BACKENDS: SDL: Fix default scale factor used in initSizeHint |
| scummvm-2.9.0pre-79-g1e46fb774b8-winxp-win32.exe | 2024-11-21 13:01 | 125M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.9.0pre-79-g1e46fb774b8-winxp-win32.7z | 2024-11-21 13:03 | 125M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.9.0pre-81-gf18147a08a8-winxp-win32.exe | 2024-11-21 13:29 | 125M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.9.0pre-81-gf18147a08a8-winxp-win32.7z | 2024-11-21 13:31 | 125M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.9.0pre-80-g3d60a8e5064-winxp-win32.exe | 2024-11-21 13:15 | 125M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.9.0pre-80-g3d60a8e5064-winxp-win32.7z | 2024-11-21 13:17 | 125M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.9.0pre-62-g6366542407e-winxp-win32.exe | 2024-11-20 00:55 | 125M | AGS: Enabled achievements for several games |
| scummvm-2.9.0pre-62-g6366542407e-winxp-win32.7z | 2024-11-20 00:57 | 125M | AGS: Enabled achievements for several games |
| scummvm-2.9.0pre-61-gebc57497ae5-winxp-win32.exe | 2024-11-20 00:39 | 125M | ACHIEVEMENTS: Generated description files |
| scummvm-2.9.0pre-61-gebc57497ae5-winxp-win32.7z | 2024-11-20 00:41 | 125M | ACHIEVEMENTS: Generated description files |
| scummvm-2.9.0pre-60-g554c00b6e89-winxp-win32.exe | 2024-11-20 00:25 | 125M | ACHIEVEMENTS: Add several AGS games |
| scummvm-2.9.0pre-60-g554c00b6e89-winxp-win32.7z | 2024-11-20 00:27 | 125M | ACHIEVEMENTS: Add several AGS games |