![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/binary.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| scummvm-2.9.0pre-123-g5bf676b2125-winxp-win32.7z | 2024-11-25 03:34 | 125M | NEWS: Mention Sword25 improvements |
| scummvm-2.9.0pre-123-g5bf676b2125-winxp-win32.exe | 2024-11-25 03:33 | 125M | NEWS: Mention Sword25 improvements |
| scummvm-2.9.0pre-122-g95979a45ddc-winxp-win32.7z | 2024-11-25 03:19 | 125M | SWORD25: Fix color picking from lightmaps. Fixes bug #13504 |
| scummvm-2.9.0pre-122-g95979a45ddc-winxp-win32.exe | 2024-11-25 03:17 | 125M | SWORD25: Fix color picking from lightmaps. Fixes bug #13504 |
| scummvm-2.9.0pre-121-g5dfc17cc8fd-winxp-win32.7z | 2024-11-25 00:24 | 125M | SWORD25: Properly implement background sound looping. Fixes bug #15424 |
| scummvm-2.9.0pre-121-g5dfc17cc8fd-winxp-win32.exe | 2024-11-25 00:20 | 125M | SWORD25: Properly implement background sound looping. Fixes bug #15424 |
| scummvm-2.9.0pre-120-g2b6ced56464-winxp-win32.7z | 2024-11-25 00:07 | 125M | SWORD25: Avoid double free on macOS and maybe other platforms on exit |
| scummvm-2.9.0pre-120-g2b6ced56464-winxp-win32.exe | 2024-11-25 00:05 | 125M | SWORD25: Avoid double free on macOS and maybe other platforms on exit |
| scummvm-2.9.0pre-119-gc3c5e974c40-winxp-win32.7z | 2024-11-24 23:49 | 125M | SWORD25: Improved debug output |
| scummvm-2.9.0pre-119-gc3c5e974c40-winxp-win32.exe | 2024-11-24 23:47 | 125M | SWORD25: Improved debug output |
| scummvm-2.9.0pre-118-g775990bdac4-winxp-win32.7z | 2024-11-24 23:35 | 125M | SWORD25: Fix heap overflow on savegameame load |
| scummvm-2.9.0pre-118-g775990bdac4-winxp-win32.exe | 2024-11-24 23:32 | 125M | SWORD25: Fix heap overflow on savegameame load |
| scummvm-2.9.0pre-117-g0fb378dd227-winxp-win32.7z | 2024-11-24 22:14 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-117-g0fb378dd227-winxp-win32.exe | 2024-11-24 22:12 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-116-g6e6d79fcea6-winxp-win32.7z | 2024-11-24 15:49 | 125M | DIRECTOR: Add two games |
| scummvm-2.9.0pre-116-g6e6d79fcea6-winxp-win32.exe | 2024-11-24 15:47 | 125M | DIRECTOR: Add two games |
| scummvm-2.9.0pre-115-g42aac58e0d3-winxp-win32.7z | 2024-11-24 15:34 | 125M | DIRECTOR: Fix more filesizes in D4 entries |
| scummvm-2.9.0pre-115-g42aac58e0d3-winxp-win32.exe | 2024-11-24 15:32 | 125M | DIRECTOR: Fix more filesizes in D4 entries |
| scummvm-2.9.0pre-114-g4817e0e99a1-winxp-win32.7z | 2024-11-24 07:07 | 125M | ULTIMA: NUVIE: Use correct path for corpse gump buttons |
| scummvm-2.9.0pre-114-g4817e0e99a1-winxp-win32.exe | 2024-11-24 07:05 | 125M | ULTIMA: NUVIE: Use correct path for corpse gump buttons |
| scummvm-2.9.0pre-113-ga38bff4e6d7-winxp-win32.7z | 2024-11-24 04:31 | 125M | NEWS: Add DS and 3DS news items for v2.9.0 |
| scummvm-2.9.0pre-113-ga38bff4e6d7-winxp-win32.exe | 2024-11-24 04:29 | 125M | NEWS: Add DS and 3DS news items for v2.9.0 |
| scummvm-2.9.0pre-112-g4ab188afaea-winxp-win32.7z | 2024-11-24 04:11 | 125M | BACKENDS: 3DS: Remove unused code |
| scummvm-2.9.0pre-112-g4ab188afaea-winxp-win32.exe | 2024-11-24 04:09 | 125M | BACKENDS: 3DS: Remove unused code |
| scummvm-2.9.0pre-111-g38209260250-winxp-win32.7z | 2024-11-24 03:55 | 125M | BACKENDS: 3DS: Allocate linear memory conditionally based on system model |
| scummvm-2.9.0pre-111-g38209260250-winxp-win32.exe | 2024-11-24 03:53 | 125M | BACKENDS: 3DS: Allocate linear memory conditionally based on system model |
| scummvm-2.9.0pre-110-g11884b7f0de-winxp-win32.7z | 2024-11-23 20:38 | 125M | DOCS: Fix copy/paste error on the 3DS page |
| scummvm-2.9.0pre-110-g11884b7f0de-winxp-win32.exe | 2024-11-23 20:36 | 125M | DOCS: Fix copy/paste error on the 3DS page |
| scummvm-2.9.0pre-109-g6e5cb26f647-winxp-win32.7z | 2024-11-23 20:24 | 125M | BASE: Fix a crash on exit when the detection plugin is loaded |
| scummvm-2.9.0pre-109-g6e5cb26f647-winxp-win32.exe | 2024-11-23 20:22 | 125M | BASE: Fix a crash on exit when the detection plugin is loaded |
| scummvm-2.9.0pre-108-gdae29b1fd3a-winxp-win32.7z | 2024-11-23 04:48 | 125M | DGDS: Fix clip window setting |
| scummvm-2.9.0pre-108-gdae29b1fd3a-winxp-win32.exe | 2024-11-23 04:46 | 125M | DGDS: Fix clip window setting |
| scummvm-2.9.0pre-107-g2402a834551-winxp-win32.7z | 2024-11-23 03:51 | 125M | DGDS: Avoid potential use of deallocated memory |
| scummvm-2.9.0pre-107-g2402a834551-winxp-win32.exe | 2024-11-23 03:49 | 125M | DGDS: Avoid potential use of deallocated memory |
| scummvm-2.9.0pre-106-gf3c95e7f5d1-winxp-win32.7z | 2024-11-22 11:18 | 125M | Revert "AGI: Process events while executing commands" |
| scummvm-2.9.0pre-106-gf3c95e7f5d1-winxp-win32.exe | 2024-11-22 11:16 | 125M | Revert "AGI: Process events while executing commands" |
| scummvm-2.9.0pre-105-gce8999f6038-winxp-win32.7z | 2024-11-22 11:03 | 125M | ENGINES: Define that a game is using 3D graphics on init - bug #15521 |
| scummvm-2.9.0pre-105-gce8999f6038-winxp-win32.exe | 2024-11-22 11:01 | 125M | ENGINES: Define that a game is using 3D graphics on init - bug #15521 |
| scummvm-2.9.0pre-104-gdb7b83252be-winxp-win32.7z | 2024-11-22 10:47 | 125M | DIRECTOR: Add detection for the demo version of Safecracker |
| scummvm-2.9.0pre-104-gdb7b83252be-winxp-win32.exe | 2024-11-22 10:45 | 125M | DIRECTOR: Add detection for the demo version of Safecracker |
| scummvm-2.9.0pre-103-g81713e93d05-winxp-win32.7z | 2024-11-22 03:06 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-103-g81713e93d05-winxp-win32.exe | 2024-11-22 03:04 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-102-g0d1d86b9a5f-winxp-win32.7z | 2024-11-22 02:52 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-102-g0d1d86b9a5f-winxp-win32.exe | 2024-11-22 02:50 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-101-gc08ace2b72c-winxp-win32.7z | 2024-11-22 02:39 | 125M | BACKENDS: SDL: Fix default scale factor used in initSizeHint |
| scummvm-2.9.0pre-101-gc08ace2b72c-winxp-win32.exe | 2024-11-22 02:37 | 125M | BACKENDS: SDL: Fix default scale factor used in initSizeHint |
| scummvm-2.9.0pre-100-g677712e05a4-winxp-win32.7z | 2024-11-22 02:25 | 125M | BACKENDS: SDL: Never make window smaller in OpenGL mode when starting game |
| scummvm-2.9.0pre-100-g677712e05a4-winxp-win32.exe | 2024-11-22 02:23 | 125M | BACKENDS: SDL: Never make window smaller in OpenGL mode when starting game |
| scummvm-2.9.0pre-99-gb85952d7586-winxp-win32.7z | 2024-11-22 00:37 | 125M | KYRA: (EOB) - fix Ring of Wizardry effect |
| scummvm-2.9.0pre-99-gb85952d7586-winxp-win32.exe | 2024-11-22 00:35 | 125M | KYRA: (EOB) - fix Ring of Wizardry effect |
| scummvm-2.9.0pre-98-g971573904cf-winxp-win32.7z | 2024-11-21 22:56 | 125M | SCUMM: Extend the fix for bug #15520 to cover all v5 Mac games |
| scummvm-2.9.0pre-98-g971573904cf-winxp-win32.exe | 2024-11-21 22:54 | 125M | SCUMM: Extend the fix for bug #15520 to cover all v5 Mac games |
| scummvm-2.9.0pre-97-ga302429111d-winxp-win32.7z | 2024-11-21 22:43 | 125M | GOB: add german CD-i version of Gobliins 1 to detection |
| scummvm-2.9.0pre-97-ga302429111d-winxp-win32.exe | 2024-11-21 22:41 | 125M | GOB: add german CD-i version of Gobliins 1 to detection |
| scummvm-2.9.0pre-96-g52af61603bf-winxp-win32.7z | 2024-11-21 22:31 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-96-g52af61603bf-winxp-win32.exe | 2024-11-21 22:29 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-95-g355de3b2f85-winxp-win32.7z | 2024-11-21 22:18 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-95-g355de3b2f85-winxp-win32.exe | 2024-11-21 22:16 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-94-g05d2e52c6df-winxp-win32.7z | 2024-11-21 22:05 | 125M | SCUMM: Save mouse position for Mac GUI games, still ignore it on load |
| scummvm-2.9.0pre-94-g05d2e52c6df-winxp-win32.exe | 2024-11-21 22:03 | 125M | SCUMM: Save mouse position for Mac GUI games, still ignore it on load |
| scummvm-2.9.0pre-93-gf4567290f67-winxp-win32.7z | 2024-11-21 21:52 | 125M | SCUMM: MACGUI: Optimize Mac palette handling (bug #15492) |
| scummvm-2.9.0pre-93-gf4567290f67-winxp-win32.exe | 2024-11-21 21:50 | 125M | SCUMM: MACGUI: Optimize Mac palette handling (bug #15492) |
| scummvm-2.9.0pre-92-g1f22bda6ab5-winxp-win32.7z | 2024-11-21 21:39 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-92-g1f22bda6ab5-winxp-win32.exe | 2024-11-21 21:37 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-91-gfd8e761f8f5-winxp-win32.7z | 2024-11-21 21:25 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-91-gfd8e761f8f5-winxp-win32.exe | 2024-11-21 21:23 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-90-gd3f79b86806-winxp-win32.7z | 2024-11-21 21:12 | 125M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.9.0pre-90-gd3f79b86806-winxp-win32.exe | 2024-11-21 21:10 | 125M | SCUMM: Fix MI1 Mac cursor when loading certain saved games - bug #15520 |
| scummvm-2.9.0pre-89-gdba399b215d-winxp-win32.7z | 2024-11-21 20:58 | 125M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.9.0pre-89-gdba399b215d-winxp-win32.exe | 2024-11-21 20:56 | 125M | SCUMM: Fix crash adding the Mac Steam version of Loom |
| scummvm-2.9.0pre-88-g27c2dd0e6be-winxp-win32.7z | 2024-11-21 19:42 | 125M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.9.0pre-88-g27c2dd0e6be-winxp-win32.exe | 2024-11-21 19:40 | 125M | TOLTECS: Support the original demo file structure - bug #13231 |
| scummvm-2.9.0pre-87-g68723bfce2f-winxp-win32.7z | 2024-11-21 19:29 | 125M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.9.0pre-87-g68723bfce2f-winxp-win32.exe | 2024-11-21 19:27 | 125M | TOLTECS: Move detection entries into a separate file |
| scummvm-2.9.0pre-86-g209183da76a-winxp-win32.7z | 2024-11-21 16:29 | 125M | I18N: Update translation (Chinese (Simplified Han script)) |
| scummvm-2.9.0pre-86-g209183da76a-winxp-win32.exe | 2024-11-21 16:27 | 125M | I18N: Update translation (Chinese (Simplified Han script)) |
| scummvm-2.9.0pre-85-g6088402a9a7-winxp-win32.7z | 2024-11-21 16:11 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-85-g6088402a9a7-winxp-win32.exe | 2024-11-21 16:09 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-84-ge44ccff5a24-winxp-win32.7z | 2024-11-21 15:50 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-84-ge44ccff5a24-winxp-win32.exe | 2024-11-21 15:48 | 125M | I18N: Update translation (French) |
| scummvm-2.9.0pre-83-g8b09fecb8d9-winxp-win32.7z | 2024-11-21 14:19 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-83-g8b09fecb8d9-winxp-win32.exe | 2024-11-21 14:17 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-82-gf833958bd7a-winxp-win32.7z | 2024-11-21 13:48 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-82-gf833958bd7a-winxp-win32.exe | 2024-11-21 13:46 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-81-gf18147a08a8-winxp-win32.7z | 2024-11-21 13:31 | 125M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.9.0pre-81-gf18147a08a8-winxp-win32.exe | 2024-11-21 13:29 | 125M | BACKENDS: ATARI: Remove move16 code |
| scummvm-2.9.0pre-80-g3d60a8e5064-winxp-win32.7z | 2024-11-21 13:17 | 125M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.9.0pre-80-g3d60a8e5064-winxp-win32.exe | 2024-11-21 13:15 | 125M | BACKENDS: ATARI: Final screen resolution changes |
| scummvm-2.9.0pre-79-g1e46fb774b8-winxp-win32.7z | 2024-11-21 13:03 | 125M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.9.0pre-79-g1e46fb774b8-winxp-win32.exe | 2024-11-21 13:01 | 125M | BACKENDS: ATARI: Use DISABLE_TEXT_CONSOLE for release builds |
| scummvm-2.9.0pre-78-gfb53ab6511d-winxp-win32.7z | 2024-11-21 07:13 | 125M | I18N: Update translation (Japanese) |
| scummvm-2.9.0pre-78-gfb53ab6511d-winxp-win32.exe | 2024-11-21 07:11 | 125M | I18N: Update translation (Japanese) |
| scummvm-2.9.0pre-77-g74be1c4b816-winxp-win32.7z | 2024-11-21 02:10 | 125M | TETRAEDGE: Fix exit confirmation for Syberia II - bug #14352 |
| scummvm-2.9.0pre-77-g74be1c4b816-winxp-win32.exe | 2024-11-21 02:07 | 125M | TETRAEDGE: Fix exit confirmation for Syberia II - bug #14352 |
| scummvm-2.9.0pre-76-g2d45d35b14f-winxp-win32.7z | 2024-11-20 23:26 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-76-g2d45d35b14f-winxp-win32.exe | 2024-11-20 23:24 | 125M | I18N: Update translation files |
| scummvm-2.9.0pre-75-g8b4f333e7c9-winxp-win32.7z | 2024-11-20 23:09 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-75-g8b4f333e7c9-winxp-win32.exe | 2024-11-20 23:07 | 125M | I18N: Update translations templates |
| scummvm-2.9.0pre-74-gdcefad88690-winxp-win32.7z | 2024-11-20 22:52 | 125M | SCUMM: DOTT: Disable copy protection |
| scummvm-2.9.0pre-74-gdcefad88690-winxp-win32.exe | 2024-11-20 22:50 | 125M | SCUMM: DOTT: Disable copy protection |